C5H16O14P4 — CID 87590425
3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate (PubChem CID 87590425) has the molecular formula C5H16O14P4 and a molecular weight of 424.07 g/mol. Its IUPAC name is 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate.
| Compound Name | 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 87590425 |
| Molecular Formula | C5H16O14P4 |
| Molecular Weight | 424.07 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate |
| SMILES | CC(C)=CCOP(=O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O7P2.H4O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-8(2,3)7-9(4,5)6/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);(H2,1,2,3)(H2,4,5,6) |
| InChIKey | OLCKYWFTQKYZIK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 237.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.07 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|