3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate

C5H16O14P4 — CID 87590425

IUPAC3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
SMILESCC(C)=CCOP(=O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)O
InChIInChI=1S/C5H12O7P2.H4O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-8(2,3)7-9(4,5)6/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);(H2,1,2,3)(H2,4,5,6)
InChIKeyOLCKYWFTQKYZIK-UHFFFAOYSA-N
MW424.07 g/mol
LogP0.37
Rot. Bonds7

About 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate

3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate (PubChem CID 87590425) has the molecular formula C5H16O14P4 and a molecular weight of 424.07 g/mol. Its IUPAC name is 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate.

Molecular Properties

Compound Name3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
PubChem CID87590425
Molecular FormulaC5H16O14P4
Molecular Weight424.07 g/mol
Exact Mass423.95
IUPAC Name3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
SMILESCC(C)=CCOP(=O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)O
InChIInChI=1S/C5H12O7P2.H4O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-8(2,3)7-9(4,5)6/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);(H2,1,2,3)(H2,4,5,6)
InChIKeyOLCKYWFTQKYZIK-UHFFFAOYSA-N
XLogP0.37
TPSA237.58 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500424.07
LogP ≤ 50.37
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The IUPAC name of 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate (CID 87590425) is 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate.
What is the SMILES notation for 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The canonical SMILES for 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate is CC(C)=CCOP(=O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)O.
What is the InChIKey of 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The InChIKey is OLCKYWFTQKYZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O7P2.H4O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-8(2,3)7-9(4,5)6/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);(H2,1,2,3)(H2,4,5,6).
What are the key properties of 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate has a molecular weight of 424.07 g/mol, XLogP of 0.37, 7 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate is sourced from PubChem (CID 87590425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).