C10H23O11P3 — CID 146257613
3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate (PubChem CID 146257613) has the molecular formula C10H23O11P3 and a molecular weight of 412.21 g/mol. Its IUPAC name is 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate.
| Compound Name | 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146257613 |
| Molecular Formula | C10H23O11P3 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate |
| SMILES | CC(C)=CCOP(=O)(O)O.CC(C)=CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O7P2.C5H11O4P/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-5(2)3-4-9-10(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);3H,4H2,1-2H3,(H2,6,7,8) |
| InChIKey | DNCOAOPDLCEBOS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|