3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate

C10H23O11P3 — CID 146257613

IUPAC3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate
SMILESCC(C)=CCOP(=O)(O)O.CC(C)=CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H12O7P2.C5H11O4P/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-5(2)3-4-9-10(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);3H,4H2,1-2H3,(H2,6,7,8)
InChIKeyDNCOAOPDLCEBOS-UHFFFAOYSA-N
MW412.21 g/mol
LogP2.24
Rot. Bonds8

About 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate

3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate (PubChem CID 146257613) has the molecular formula C10H23O11P3 and a molecular weight of 412.21 g/mol. Its IUPAC name is 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate.

Molecular Properties

Compound Name3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate
PubChem CID146257613
Molecular FormulaC10H23O11P3
Molecular Weight412.21 g/mol
Exact Mass412.05
IUPAC Name3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate
SMILESCC(C)=CCOP(=O)(O)O.CC(C)=CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H12O7P2.C5H11O4P/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-5(2)3-4-9-10(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);3H,4H2,1-2H3,(H2,6,7,8)
InChIKeyDNCOAOPDLCEBOS-UHFFFAOYSA-N
XLogP2.24
TPSA180.05 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500412.21
LogP ≤ 52.24
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate?
The IUPAC name of 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate (CID 146257613) is 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate.
What is the SMILES notation for 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate?
The canonical SMILES for 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate is CC(C)=CCOP(=O)(O)O.CC(C)=CCOP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate?
The InChIKey is DNCOAOPDLCEBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O7P2.C5H11O4P/c1-5(2)3-4-11-14(9,10)12-13(6,7)8;1-5(2)3-4-9-10(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8);3H,4H2,1-2H3,(H2,6,7,8).
What are the key properties of 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate?
3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate has a molecular weight of 412.21 g/mol, XLogP of 2.24, 8 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl dihydrogen phosphate;3-methylbut-2-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 146257613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).