C12H25NO7P2 — CID 167165873
[(2E,6E)-10-amino-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 167165873) has the molecular formula C12H25NO7P2 and a molecular weight of 357.28 g/mol. Its IUPAC name is [(2E,6E)-10-amino-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-10-amino-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167165873 |
| Molecular Formula | C12H25NO7P2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [(2E,6E)-10-amino-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CCCN |
| InChI | InChI=1S/C12H25NO7P2/c1-11(7-4-9-13)5-3-6-12(2)8-10-19-22(17,18)20-21(14,15)16/h5,8H,3-4,6-7,9-10,13H2,1-2H3,(H,17,18)(H2,14,15,16)/b11-5+,12-8+ |
| InChIKey | SRIXYFWXDNXBDX-QAZZFAKDSA-N |
| XLogP | 2.62 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|