C15H30O7P2 — CID 127049367
[(2E,6E)-3,7-dimethyltrideca-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 127049367) has the molecular formula C15H30O7P2 and a molecular weight of 384.35 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyltrideca-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-3,7-dimethyltrideca-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 127049367 |
| Molecular Formula | C15H30O7P2 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [(2E,6E)-3,7-dimethyltrideca-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | CCCCCC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H30O7P2/c1-4-5-6-7-9-14(2)10-8-11-15(3)12-13-21-24(19,20)22-23(16,17)18/h10,12H,4-9,11,13H2,1-3H3,(H,19,20)(H2,16,17,18)/b14-10+,15-12+ |
| InChIKey | IYHFEEQPTBFYNK-VDQVFBMKSA-N |
| XLogP | 4.86 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|