[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate

C13H26O8P2 — CID 10339229

IUPAC[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate
SMILESCCCOC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C13H26O8P2/c1-4-9-19-11-13(3)7-5-6-12(2)8-10-20-23(17,18)21-22(14,15)16/h7-8H,4-6,9-11H2,1-3H3,(H,17,18)(H2,14,15,16)/b12-8+,13-7+
InChIKeyIJSINOQZNYSRJA-SWZPTJTJSA-N
MW372.29 g/mol
LogP3.31
Rot. Bonds12

About [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate

[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 10339229) has the molecular formula C13H26O8P2 and a molecular weight of 372.29 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate.

Molecular Properties

Compound Name[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate
PubChem CID10339229
Molecular FormulaC13H26O8P2
Molecular Weight372.29 g/mol
Exact Mass372.11
IUPAC Name[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate
SMILESCCCOC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C13H26O8P2/c1-4-9-19-11-13(3)7-5-6-12(2)8-10-20-23(17,18)21-22(14,15)16/h7-8H,4-6,9-11H2,1-3H3,(H,17,18)(H2,14,15,16)/b12-8+,13-7+
InChIKeyIJSINOQZNYSRJA-SWZPTJTJSA-N
XLogP3.31
TPSA122.52 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds12
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.29
LogP ≤ 53.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate?
The IUPAC name of [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate (CID 10339229) is [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate.
What is the SMILES notation for [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate?
The canonical SMILES for [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate is CCCOC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O.
What is the InChIKey of [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate?
The InChIKey is IJSINOQZNYSRJA-SWZPTJTJSA-N. The full InChI is InChI=1S/C13H26O8P2/c1-4-9-19-11-13(3)7-5-6-12(2)8-10-20-23(17,18)21-22(14,15)16/h7-8H,4-6,9-11H2,1-3H3,(H,17,18)(H2,14,15,16)/b12-8+,13-7+.
What are the key properties of [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate?
[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate has a molecular weight of 372.29 g/mol, XLogP of 3.31, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate is sourced from PubChem (CID 10339229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).