C13H26O8P2 — CID 10339229
[(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 10339229) has the molecular formula C13H26O8P2 and a molecular weight of 372.29 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10339229 |
| Molecular Formula | C13H26O8P2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-propoxyocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | CCCOC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H26O8P2/c1-4-9-19-11-13(3)7-5-6-12(2)8-10-20-23(17,18)21-22(14,15)16/h7-8H,4-6,9-11H2,1-3H3,(H,17,18)(H2,14,15,16)/b12-8+,13-7+ |
| InChIKey | IJSINOQZNYSRJA-SWZPTJTJSA-N |
| XLogP | 3.31 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|