C16H30ClN — CID 146245977
(6Z)-6-(chloromethyl)-N,N,2-trimethyldodeca-1,6-dien-3-amine (PubChem CID 146245977) has the molecular formula C16H30ClN and a molecular weight of 271.88 g/mol. Its IUPAC name is (6Z)-6-(chloromethyl)-N,N,2-trimethyldodeca-1,6-dien-3-amine.
| Compound Name | (6Z)-6-(chloromethyl)-N,N,2-trimethyldodeca-1,6-dien-3-amine |
|---|---|
| PubChem CID | 146245977 |
| Molecular Formula | C16H30ClN |
| Molecular Weight | 271.88 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (6Z)-6-(chloromethyl)-N,N,2-trimethyldodeca-1,6-dien-3-amine |
| SMILES | C=C(C)C(CC/C(=C/CCCCC)CCl)N(C)C |
| InChI | InChI=1S/C16H30ClN/c1-6-7-8-9-10-15(13-17)11-12-16(14(2)3)18(4)5/h10,16H,2,6-9,11-13H2,1,3-5H3/b15-10- |
| InChIKey | YMVWMMIBZRATRM-GDNBJRDFSA-N |
| XLogP | 5.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|