About (4E)-4-propylundeca-1,4-diene
(4E)-4-propylundeca-1,4-diene (PubChem CID 134903488) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is (4E)-4-propylundeca-1,4-diene.
Molecular Properties
| Compound Name | (4E)-4-propylundeca-1,4-diene |
| PubChem CID | 134903488 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (4E)-4-propylundeca-1,4-diene |
| SMILES | C=CC/C(=C/CCCCCC)CCC |
| InChI | InChI=1S/C14H26/c1-4-7-8-9-10-13-14(11-5-2)12-6-3/h5,13H,2,4,6-12H2,1,3H3/b14-13- |
| InChIKey | AAXVNYXTXOWTFJ-YPKPFQOOSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-propylundeca-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-propylundeca-1,4-diene?
The IUPAC name of (4E)-4-propylundeca-1,4-diene (CID 134903488) is (4E)-4-propylundeca-1,4-diene.
What is the SMILES notation for (4E)-4-propylundeca-1,4-diene?
The canonical SMILES for (4E)-4-propylundeca-1,4-diene is C=CC/C(=C/CCCCCC)CCC.
What is the InChIKey of (4E)-4-propylundeca-1,4-diene?
The InChIKey is AAXVNYXTXOWTFJ-YPKPFQOOSA-N. The full InChI is InChI=1S/C14H26/c1-4-7-8-9-10-13-14(11-5-2)12-6-3/h5,13H,2,4,6-12H2,1,3H3/b14-13-.
What are the key properties of (4E)-4-propylundeca-1,4-diene?
(4E)-4-propylundeca-1,4-diene has a molecular weight of 194.36 g/mol, XLogP of 5.26, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-propylundeca-1,4-diene is sourced from PubChem (CID 134903488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).