C13H21N — CID 167108317
(5Z)-2-methylidene-6-propylnona-5,8-dien-1-imine (PubChem CID 167108317) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (5Z)-2-methylidene-6-propylnona-5,8-dien-1-imine.
| Compound Name | (5Z)-2-methylidene-6-propylnona-5,8-dien-1-imine |
|---|---|
| PubChem CID | 167108317 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (5Z)-2-methylidene-6-propylnona-5,8-dien-1-imine |
| SMILES | [H]/N=C/C(=C)CC/C=C(\CC=C)CCC |
| InChI | InChI=1S/C13H21N/c1-4-7-13(8-5-2)10-6-9-12(3)11-14/h4,10-11,14H,1,3,5-9H2,2H3/b13-10+,14-11+ |
| InChIKey | ZDGLCSTWRYYXPU-IFQMDVHZSA-N |
| XLogP | 4.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|