C14H27BO2 — CID 11550447
di(propan-2-yloxy)-[(1Z)-2-propylpenta-1,4-dienyl]borane (PubChem CID 11550447) has the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. Its IUPAC name is di(propan-2-yloxy)-[(1Z)-2-propylpenta-1,4-dienyl]borane.
| Compound Name | di(propan-2-yloxy)-[(1Z)-2-propylpenta-1,4-dienyl]borane |
|---|---|
| PubChem CID | 11550447 |
| Molecular Formula | C14H27BO2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | di(propan-2-yloxy)-[(1Z)-2-propylpenta-1,4-dienyl]borane |
| SMILES | C=CC/C(=C\B(OC(C)C)OC(C)C)CCC |
| InChI | InChI=1S/C14H27BO2/c1-7-9-14(10-8-2)11-15(16-12(3)4)17-13(5)6/h7,11-13H,1,8-10H2,2-6H3/b14-11+ |
| InChIKey | FIUDUXBWKVXDEF-SDNWHVSQSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|