C19H29NO — CID 167074200
(5Z)-2-ethenyl-N-[[(1E)-2-propylpenta-1,4-dienoxy]methyl]octa-2,3,5-trien-1-amine (PubChem CID 167074200) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (5Z)-2-ethenyl-N-[[(1E)-2-propylpenta-1,4-dienoxy]methyl]octa-2,3,5-trien-1-amine.
| Compound Name | (5Z)-2-ethenyl-N-[[(1E)-2-propylpenta-1,4-dienoxy]methyl]octa-2,3,5-trien-1-amine |
|---|---|
| PubChem CID | 167074200 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (5Z)-2-ethenyl-N-[[(1E)-2-propylpenta-1,4-dienoxy]methyl]octa-2,3,5-trien-1-amine |
| SMILES | C=CC/C(=C/OCNCC(=C=C/C=C\CC)C=C)CCC |
| InChI | InChI=1S/C19H29NO/c1-5-9-10-11-14-18(8-4)15-20-17-21-16-19(12-6-2)13-7-3/h6,8-11,16,20H,2,4-5,7,12-13,15,17H2,1,3H3/b10-9-,19-16- |
| InChIKey | WUFZQSZUFBUFEO-JSKOQASCSA-N |
| XLogP | 5.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|