About (E)-non-2-enal;oct-1-en-3-one
(E)-non-2-enal;oct-1-en-3-one (PubChem CID 140527205) has the molecular formula C17H30O2
and a molecular weight of 266.43 g/mol. Its IUPAC name is (E)-non-2-enal;oct-1-en-3-one.
Molecular Properties
| Compound Name | (E)-non-2-enal;oct-1-en-3-one |
| PubChem CID | 140527205 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (E)-non-2-enal;oct-1-en-3-one |
| SMILES | C=CC(=O)CCCCC.CCCCCC/C=C/C=O |
| InChI | InChI=1S/C9H16O.C8H14O/c1-2-3-4-5-6-7-8-9-10;1-3-5-6-7-8(9)4-2/h7-9H,2-6H2,1H3;4H,2-3,5-7H2,1H3/b8-7+; |
| InChIKey | ZDLCFJWSKGCWOE-USRGLUTNSA-N |
| XLogP | 5.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-non-2-enal;oct-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-non-2-enal;oct-1-en-3-one?
The IUPAC name of (E)-non-2-enal;oct-1-en-3-one (CID 140527205) is (E)-non-2-enal;oct-1-en-3-one.
What is the SMILES notation for (E)-non-2-enal;oct-1-en-3-one?
The canonical SMILES for (E)-non-2-enal;oct-1-en-3-one is C=CC(=O)CCCCC.CCCCCC/C=C/C=O.
What is the InChIKey of (E)-non-2-enal;oct-1-en-3-one?
The InChIKey is ZDLCFJWSKGCWOE-USRGLUTNSA-N. The full InChI is InChI=1S/C9H16O.C8H14O/c1-2-3-4-5-6-7-8-9-10;1-3-5-6-7-8(9)4-2/h7-9H,2-6H2,1H3;4H,2-3,5-7H2,1H3/b8-7+;.
What are the key properties of (E)-non-2-enal;oct-1-en-3-one?
(E)-non-2-enal;oct-1-en-3-one has a molecular weight of 266.43 g/mol, XLogP of 5.03, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-non-2-enal;oct-1-en-3-one is sourced from PubChem (CID 140527205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).