C12H18O — CID 11769109
(8E,10E)-dodeca-1,8,10-trien-3-one (PubChem CID 11769109) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (8E,10E)-dodeca-1,8,10-trien-3-one.
| Compound Name | (8E,10E)-dodeca-1,8,10-trien-3-one |
|---|---|
| PubChem CID | 11769109 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (8E,10E)-dodeca-1,8,10-trien-3-one |
| SMILES | C=CC(=O)CCCC/C=C/C=C/C |
| InChI | InChI=1S/C12H18O/c1-3-5-6-7-8-9-10-11-12(13)4-2/h3-7H,2,8-11H2,1H3/b5-3+,7-6+ |
| InChIKey | YHANARFJYUXAOR-TWTPFVCWSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|