About (11E)-trideca-9,11-dien-2-one
(11E)-trideca-9,11-dien-2-one (PubChem CID 161147257) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is (11E)-trideca-9,11-dien-2-one.
Molecular Properties
| Compound Name | (11E)-trideca-9,11-dien-2-one |
| PubChem CID | 161147257 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (11E)-trideca-9,11-dien-2-one |
| SMILES | C/C=C/C=CCCCCCCC(C)=O |
| InChI | InChI=1S/C13H22O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-6H,7-12H2,1-2H3/b4-3+,6-5? |
| InChIKey | AONIWEXQQQENHE-WAVJCGAHSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (11E)-trideca-9,11-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11E)-trideca-9,11-dien-2-one?
The IUPAC name of (11E)-trideca-9,11-dien-2-one (CID 161147257) is (11E)-trideca-9,11-dien-2-one.
What is the SMILES notation for (11E)-trideca-9,11-dien-2-one?
The canonical SMILES for (11E)-trideca-9,11-dien-2-one is C/C=C/C=CCCCCCCC(C)=O.
What is the InChIKey of (11E)-trideca-9,11-dien-2-one?
The InChIKey is AONIWEXQQQENHE-WAVJCGAHSA-N. The full InChI is InChI=1S/C13H22O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-6H,7-12H2,1-2H3/b4-3+,6-5?.
What are the key properties of (11E)-trideca-9,11-dien-2-one?
(11E)-trideca-9,11-dien-2-one has a molecular weight of 194.32 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (11E)-trideca-9,11-dien-2-one is sourced from PubChem (CID 161147257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).