C15H24O — CID 90453411
(10Z,12E)-pentadeca-10,12,14-trien-2-one (PubChem CID 90453411) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (10Z,12E)-pentadeca-10,12,14-trien-2-one.
| Compound Name | (10Z,12E)-pentadeca-10,12,14-trien-2-one |
|---|---|
| PubChem CID | 90453411 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (10Z,12E)-pentadeca-10,12,14-trien-2-one |
| SMILES | C=C/C=C/C=C\CCCCCCCC(C)=O |
| InChI | InChI=1S/C15H24O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h3-7H,1,8-14H2,2H3/b5-4+,7-6- |
| InChIKey | CXRCLLBYUDUYHB-DEQVHDEQSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|