C15H22O — CID 22957036
(6E,9E,12E)-pentadeca-6,9,12,14-tetraen-2-one (PubChem CID 22957036) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (6E,9E,12E)-pentadeca-6,9,12,14-tetraen-2-one.
| Compound Name | (6E,9E,12E)-pentadeca-6,9,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 22957036 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (6E,9E,12E)-pentadeca-6,9,12,14-tetraen-2-one |
| SMILES | C=C/C=C/C/C=C/C/C=C/CCCC(C)=O |
| InChI | InChI=1S/C15H22O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h3-5,7-8,10-11H,1,6,9,12-14H2,2H3/b5-4+,8-7+,11-10+ |
| InChIKey | IFRMWYPYPANZMC-JSIPCRQOSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|