C13H18O — CID 175909143
trideca-5,7,10,12-tetraen-2-one (PubChem CID 175909143) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is trideca-5,7,10,12-tetraen-2-one.
| Compound Name | trideca-5,7,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 175909143 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | trideca-5,7,10,12-tetraen-2-one |
| SMILES | C=CC=CCC=CC=CCCC(C)=O |
| InChI | InChI=1S/C13H18O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-5,7-10H,1,6,11-12H2,2H3 |
| InChIKey | RQDNVGXFLNSCOX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|