C23H34O3 — CID 87067085
(5Z,8Z,12Z,14Z,17Z,19E)-11,21-dihydroxytricosa-5,8,12,14,17,19-hexaen-2-one (PubChem CID 87067085) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (5Z,8Z,12Z,14Z,17Z,19E)-11,21-dihydroxytricosa-5,8,12,14,17,19-hexaen-2-one.
| Compound Name | (5Z,8Z,12Z,14Z,17Z,19E)-11,21-dihydroxytricosa-5,8,12,14,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 87067085 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (5Z,8Z,12Z,14Z,17Z,19E)-11,21-dihydroxytricosa-5,8,12,14,17,19-hexaen-2-one |
| SMILES | CCC(O)/C=C/C=C\C/C=C\C=C/C(O)C/C=C\C/C=C\CCC(C)=O |
| InChI | InChI=1S/C23H34O3/c1-3-22(25)18-14-10-5-4-6-11-15-19-23(26)20-16-12-8-7-9-13-17-21(2)24/h5-7,9-12,14-16,18-19,22-23,25-26H,3-4,8,13,17,20H2,1-2H3/b9-7-,10-5-,11-6-,16-12-,18-14+,19-15- |
| InChIKey | OEDYKXMSMWAEOH-PITVISLESA-N |
| XLogP | 4.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|