C22H34O3 — CID 73021200
7-hydroxydocosa-4,8,10,13,16-pentaenoic acid (PubChem CID 73021200) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid.
| Compound Name | 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid |
|---|---|
| PubChem CID | 73021200 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid |
| SMILES | CCCCCC=CCC=CCC=CC=CC(O)CC=CCCC(=O)O |
| InChI | InChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21(23)19-16-14-17-20-22(24)25/h6-7,9-10,12-16,18,21,23H,2-5,8,11,17,19-20H2,1H3,(H,24,25) |
| InChIKey | YMWAPFGVXULOOY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|