7-hydroxydocosa-4,8,10,13,16-pentaenoic acid

C22H34O3 — CID 73021200

IUPAC7-hydroxydocosa-4,8,10,13,16-pentaenoic acid
SMILESCCCCCC=CCC=CCC=CC=CC(O)CC=CCCC(=O)O
InChIInChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21(23)19-16-14-17-20-22(24)25/h6-7,9-10,12-16,18,21,23H,2-5,8,11,17,19-20H2,1H3,(H,24,25)
InChIKeyYMWAPFGVXULOOY-UHFFFAOYSA-N
MW346.51 g/mol
LogP5.74
Rot. Bonds15

About 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid

7-hydroxydocosa-4,8,10,13,16-pentaenoic acid (PubChem CID 73021200) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid.

Molecular Properties

Compound Name7-hydroxydocosa-4,8,10,13,16-pentaenoic acid
PubChem CID73021200
Molecular FormulaC22H34O3
Molecular Weight346.51 g/mol
Exact Mass346.25
IUPAC Name7-hydroxydocosa-4,8,10,13,16-pentaenoic acid
SMILESCCCCCC=CCC=CCC=CC=CC(O)CC=CCCC(=O)O
InChIInChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21(23)19-16-14-17-20-22(24)25/h6-7,9-10,12-16,18,21,23H,2-5,8,11,17,19-20H2,1H3,(H,24,25)
InChIKeyYMWAPFGVXULOOY-UHFFFAOYSA-N
XLogP5.74
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500346.51
LogP ≤ 55.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid?
The IUPAC name of 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid (CID 73021200) is 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid.
What is the SMILES notation for 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid?
The canonical SMILES for 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid is CCCCCC=CCC=CCC=CC=CC(O)CC=CCCC(=O)O.
What is the InChIKey of 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid?
The InChIKey is YMWAPFGVXULOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21(23)19-16-14-17-20-22(24)25/h6-7,9-10,12-16,18,21,23H,2-5,8,11,17,19-20H2,1H3,(H,24,25).
What are the key properties of 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid?
7-hydroxydocosa-4,8,10,13,16-pentaenoic acid has a molecular weight of 346.51 g/mol, XLogP of 5.74, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxydocosa-4,8,10,13,16-pentaenoic acid is sourced from PubChem (CID 73021200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).