C22H34O4 — CID 25020398
(4Z,6E,10Z,12Z,16Z)-8,14-dihydroxydocosa-4,6,10,12,16-pentaenoic acid (PubChem CID 25020398) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4Z,6E,10Z,12Z,16Z)-8,14-dihydroxydocosa-4,6,10,12,16-pentaenoic acid.
| Compound Name | (4Z,6E,10Z,12Z,16Z)-8,14-dihydroxydocosa-4,6,10,12,16-pentaenoic acid |
|---|---|
| PubChem CID | 25020398 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4Z,6E,10Z,12Z,16Z)-8,14-dihydroxydocosa-4,6,10,12,16-pentaenoic acid |
| SMILES | CCCCC/C=C\CC(O)/C=C\C=C/CC(O)/C=C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H34O4/c1-2-3-4-5-6-10-15-20(23)17-12-9-13-18-21(24)16-11-7-8-14-19-22(25)26/h6-13,16-17,20-21,23-24H,2-5,14-15,18-19H2,1H3,(H,25,26)/b8-7-,10-6-,13-9-,16-11+,17-12- |
| InChIKey | DOONJIAALCHYIC-CCYMRINTSA-N |
| XLogP | 4.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|