C16H26O3 — CID 6443898
(4E,7Z,9Z)-11-hydroxyhexadeca-4,7,9-trienoic acid (PubChem CID 6443898) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (4E,7Z,9Z)-11-hydroxyhexadeca-4,7,9-trienoic acid.
| Compound Name | (4E,7Z,9Z)-11-hydroxyhexadeca-4,7,9-trienoic acid |
|---|---|
| PubChem CID | 6443898 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (4E,7Z,9Z)-11-hydroxyhexadeca-4,7,9-trienoic acid |
| SMILES | CCCCCC(O)/C=C\C=C/C/C=C/CCC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-2-3-9-12-15(17)13-10-7-5-4-6-8-11-14-16(18)19/h5-8,10,13,15,17H,2-4,9,11-12,14H2,1H3,(H,18,19)/b7-5-,8-6+,13-10- |
| InChIKey | YZHSZFKKUWTIQI-ZAMVPFCSSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|