C23H36O4 — CID 170058257
(4Z,8E,10Z,13Z,15E)-7-hydroxy-17-(hydroxymethyl)docosa-4,8,10,13,15-pentaenoic acid (PubChem CID 170058257) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4Z,8E,10Z,13Z,15E)-7-hydroxy-17-(hydroxymethyl)docosa-4,8,10,13,15-pentaenoic acid.
| Compound Name | (4Z,8E,10Z,13Z,15E)-7-hydroxy-17-(hydroxymethyl)docosa-4,8,10,13,15-pentaenoic acid |
|---|---|
| PubChem CID | 170058257 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (4Z,8E,10Z,13Z,15E)-7-hydroxy-17-(hydroxymethyl)docosa-4,8,10,13,15-pentaenoic acid |
| SMILES | CCCCCC(/C=C/C=C\C/C=C\C=C\C(O)C/C=C\CCC(=O)O)CO |
| InChI | InChI=1S/C23H36O4/c1-2-3-10-15-21(20-24)16-11-7-5-4-6-8-12-17-22(25)18-13-9-14-19-23(26)27/h5-9,11-13,16-17,21-22,24-25H,2-4,10,14-15,18-20H2,1H3,(H,26,27)/b7-5-,8-6-,13-9-,16-11+,17-12+ |
| InChIKey | FGCQBOPVNCCVKH-VRPHVWDQSA-N |
| XLogP | 4.96 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|