C21H30O3 — CID 89037704
(4Z,7S,8E,10Z,12Z,15Z,18Z)-7-hydroxyhenicosa-4,8,10,12,15,18-hexaenoic acid (PubChem CID 89037704) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (4Z,7S,8E,10Z,12Z,15Z,18Z)-7-hydroxyhenicosa-4,8,10,12,15,18-hexaenoic acid.
| Compound Name | (4Z,7S,8E,10Z,12Z,15Z,18Z)-7-hydroxyhenicosa-4,8,10,12,15,18-hexaenoic acid |
|---|---|
| PubChem CID | 89037704 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (4Z,7S,8E,10Z,12Z,15Z,18Z)-7-hydroxyhenicosa-4,8,10,12,15,18-hexaenoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C/C=C/[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C21H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-20(22)18-15-13-16-19-21(23)24/h3-4,6-7,9-15,17,20,22H,2,5,8,16,18-19H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,12-11-,15-13-,17-14+/t20-/m1/s1 |
| InChIKey | BATOZAOEPUYVTB-OKTGNCHASA-N |
| XLogP | 5.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|