C22H32O4 — CID 123964857
(7R,14S)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid (PubChem CID 123964857) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (7R,14S)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid.
| Compound Name | (7R,14S)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 123964857 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (7R,14S)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid |
| SMILES | CCC=CCC=CC[C@H](O)C=CC=CC=C[C@H](O)CC=CCCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-6-10-15-20(23)16-11-7-8-12-17-21(24)18-13-9-14-19-22(25)26/h3-4,6-13,16-17,20-21,23-24H,2,5,14-15,18-19H2,1H3,(H,25,26)/t20-,21-/m0/s1 |
| InChIKey | HLHYXXBCQOUTGK-SFTDATJTSA-N |
| XLogP | 4.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|