C22H32O5 — CID 101493286
(4E,7R,8E,10E,12E,14E,17R,19E)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid (PubChem CID 101493286) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (4E,7R,8E,10E,12E,14E,17R,19E)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid.
| Compound Name | (4E,7R,8E,10E,12E,14E,17R,19E)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
|---|---|
| PubChem CID | 101493286 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (4E,7R,8E,10E,12E,14E,17R,19E)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
| SMILES | CC/C=C/C[C@@H](O)C(O)/C=C/C=C/C=C/C=C/[C@H](O)C/C=C/CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-21,23-25H,2,13,15-16,18H2,1H3,(H,26,27)/b6-4+,7-5+,9-3+,11-8+,14-10+,17-12+/t19-,20+,21?/m0/s1 |
| InChIKey | IKFAUGXNBOBQDM-FOBXUHRISA-N |
| XLogP | 3.46 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|