(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid

C22H32O4 — CID 123794420

IUPAC(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid
SMILESCCC=CC[C@H](O)C(O)C=CC=CC=CCC=CCC=CCCC(=O)O
InChIInChI=1S/C22H32O4/c1-2-3-14-17-20(23)21(24)18-15-12-10-8-6-4-5-7-9-11-13-16-19-22(25)26/h3,5-8,10-15,18,20-21,23-24H,2,4,9,16-17,19H2,1H3,(H,25,26)/t20-,21?/m0/s1
InChIKeyRHERWTKCXOXCNX-BGERDNNASA-N
MW360.49 g/mol
LogP4.49
Rot. Bonds14

About (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid

(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid (PubChem CID 123794420) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid.

Molecular Properties

Compound Name(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid
PubChem CID123794420
Molecular FormulaC22H32O4
Molecular Weight360.49 g/mol
Exact Mass360.23
IUPAC Name(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid
SMILESCCC=CC[C@H](O)C(O)C=CC=CC=CCC=CCC=CCCC(=O)O
InChIInChI=1S/C22H32O4/c1-2-3-14-17-20(23)21(24)18-15-12-10-8-6-4-5-7-9-11-13-16-19-22(25)26/h3,5-8,10-15,18,20-21,23-24H,2,4,9,16-17,19H2,1H3,(H,25,26)/t20-,21?/m0/s1
InChIKeyRHERWTKCXOXCNX-BGERDNNASA-N
XLogP4.49
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.49
LogP ≤ 54.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid?
The IUPAC name of (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid (CID 123794420) is (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid.
What is the SMILES notation for (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid?
The canonical SMILES for (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid is CCC=CC[C@H](O)C(O)C=CC=CC=CCC=CCC=CCCC(=O)O.
What is the InChIKey of (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid?
The InChIKey is RHERWTKCXOXCNX-BGERDNNASA-N. The full InChI is InChI=1S/C22H32O4/c1-2-3-14-17-20(23)21(24)18-15-12-10-8-6-4-5-7-9-11-13-16-19-22(25)26/h3,5-8,10-15,18,20-21,23-24H,2,4,9,16-17,19H2,1H3,(H,25,26)/t20-,21?/m0/s1.
What are the key properties of (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid?
(17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid has a molecular weight of 360.49 g/mol, XLogP of 4.49, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (17S)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid is sourced from PubChem (CID 123794420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).