C20H32O3 — CID 118042403
(8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-8,11,13,17-tetraenoic acid (PubChem CID 118042403) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-8,11,13,17-tetraenoic acid.
| Compound Name | (8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-8,11,13,17-tetraenoic acid |
|---|---|
| PubChem CID | 118042403 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-8,11,13,17-tetraenoic acid |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h3-5,9,11,13-14,17,19,21H,2,6-8,10,12,15-16,18H2,1H3,(H,22,23)/b5-4-,11-9-,13-3-,17-14+/t19-/m0/s1 |
| InChIKey | HWNPNBSAALEDSB-ATCUWOQKSA-N |
| XLogP | 5.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|