C18H29O3- — CID 59755726
(6Z,9Z,11E)-13-hydroxyoctadeca-6,9,11-trienoate (PubChem CID 59755726) has the molecular formula C18H29O3- and a molecular weight of 293.43 g/mol. Its IUPAC name is (6Z,9Z,11E)-13-hydroxyoctadeca-6,9,11-trienoate.
| Compound Name | (6Z,9Z,11E)-13-hydroxyoctadeca-6,9,11-trienoate |
|---|---|
| PubChem CID | 59755726 |
| Molecular Formula | C18H29O3- |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (6Z,9Z,11E)-13-hydroxyoctadeca-6,9,11-trienoate |
| SMILES | CCCCCC(O)/C=C/C=C\C/C=C\CCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h4,6-7,9,12,15,17,19H,2-3,5,8,10-11,13-14,16H2,1H3,(H,20,21)/p-1/b6-4-,9-7-,15-12+ |
| InChIKey | HNBLUNXZQNJFRB-YSHIPJNPSA-M |
| XLogP | 3.30 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|