C19H29NaO3 — CID 23694179
sodium (5Z,8Z,11Z,13E)-15-hydroxynonadeca-5,8,11,13-tetraenoate (PubChem CID 23694179) has the molecular formula C19H29NaO3 and a molecular weight of 328.43 g/mol. Its IUPAC name is sodium (5Z,8Z,11Z,13E)-15-hydroxynonadeca-5,8,11,13-tetraenoate.
| Compound Name | sodium (5Z,8Z,11Z,13E)-15-hydroxynonadeca-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 23694179 |
| Molecular Formula | C19H29NaO3 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | sodium (5Z,8Z,11Z,13E)-15-hydroxynonadeca-5,8,11,13-tetraenoate |
| SMILES | CCCCC(O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H30O3.Na/c1-2-3-15-18(20)16-13-11-9-7-5-4-6-8-10-12-14-17-19(21)22;/h4-5,8-11,13,16,18,20H,2-3,6-7,12,14-15,17H2,1H3,(H,21,22);/q;+1/p-1/b5-4-,10-8-,11-9-,16-13+; |
| InChIKey | FBYOXHKLMAHLEV-QIRWNGPISA-M |
| XLogP | 0.47 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|