C20H32O2 — CID 87523165
(3R,4E,6Z,9Z,12Z,14E,16S)-icosa-4,6,9,12,14-pentaene-3,16-diol (PubChem CID 87523165) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3R,4E,6Z,9Z,12Z,14E,16S)-icosa-4,6,9,12,14-pentaene-3,16-diol.
| Compound Name | (3R,4E,6Z,9Z,12Z,14E,16S)-icosa-4,6,9,12,14-pentaene-3,16-diol |
|---|---|
| PubChem CID | 87523165 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3R,4E,6Z,9Z,12Z,14E,16S)-icosa-4,6,9,12,14-pentaene-3,16-diol |
| SMILES | CCCC[C@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](O)CC |
| InChI | InChI=1S/C20H32O2/c1-3-5-16-20(22)18-15-13-11-9-7-6-8-10-12-14-17-19(21)4-2/h6-7,10-15,17-22H,3-5,8-9,16H2,1-2H3/b7-6-,12-10-,13-11-,17-14+,18-15+/t19-,20+/m1/s1 |
| InChIKey | GHRLNBDMRVYRGD-LDKHRGBASA-N |
| XLogP | 4.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|