C13H22O2 — CID 10846135
(2E,4E,6E)-trideca-2,4,6-triene-1,8-diol (PubChem CID 10846135) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2E,4E,6E)-trideca-2,4,6-triene-1,8-diol.
| Compound Name | (2E,4E,6E)-trideca-2,4,6-triene-1,8-diol |
|---|---|
| PubChem CID | 10846135 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2E,4E,6E)-trideca-2,4,6-triene-1,8-diol |
| SMILES | CCCCCC(O)/C=C/C=C/C=C/CO |
| InChI | InChI=1S/C13H22O2/c1-2-3-7-10-13(15)11-8-5-4-6-9-12-14/h4-6,8-9,11,13-15H,2-3,7,10,12H2,1H3/b5-4+,9-6+,11-8+ |
| InChIKey | ZUYWNIJWPDTHNS-HQXGWRNMSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|