C20H34O4 — CID 14753472
(5S,6Z,8E,10E,12R)-5,12-dihydroxyicosa-6,8,10-trienoic acid (PubChem CID 14753472) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (5S,6Z,8E,10E,12R)-5,12-dihydroxyicosa-6,8,10-trienoic acid.
| Compound Name | (5S,6Z,8E,10E,12R)-5,12-dihydroxyicosa-6,8,10-trienoic acid |
|---|---|
| PubChem CID | 14753472 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (5S,6Z,8E,10E,12R)-5,12-dihydroxyicosa-6,8,10-trienoic acid |
| SMILES | CCCCCCCC[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h7-8,10-11,14-15,18-19,21-22H,2-6,9,12-13,16-17H2,1H3,(H,23,24)/b8-7+,14-10+,15-11-/t18-,19-/m1/s1 |
| InChIKey | NGTXCORNXNELNU-CHHAPGPYSA-N |
| XLogP | 4.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|