C19H32O3 — CID 90059451
(7Z,9Z,11E)-6-hydroxy-13-methyloctadeca-7,9,11-trienoic acid (PubChem CID 90059451) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (7Z,9Z,11E)-6-hydroxy-13-methyloctadeca-7,9,11-trienoic acid.
| Compound Name | (7Z,9Z,11E)-6-hydroxy-13-methyloctadeca-7,9,11-trienoic acid |
|---|---|
| PubChem CID | 90059451 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (7Z,9Z,11E)-6-hydroxy-13-methyloctadeca-7,9,11-trienoic acid |
| SMILES | CCCCCC(C)/C=C/C=C\C=C/C(O)CCCCC(=O)O |
| InChI | InChI=1S/C19H32O3/c1-3-4-7-12-17(2)13-8-5-6-9-14-18(20)15-10-11-16-19(21)22/h5-6,8-9,13-14,17-18,20H,3-4,7,10-12,15-16H2,1-2H3,(H,21,22)/b6-5-,13-8+,14-9- |
| InChIKey | YRIWWNPDYOIYCH-JCPZSIEVSA-N |
| XLogP | 4.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|