C19H34O3 — CID 125480190
(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid (PubChem CID 125480190) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid.
| Compound Name | (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid |
|---|---|
| PubChem CID | 125480190 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H34O3/c1-2-3-12-15-18(20)16-13-10-8-6-4-5-7-9-11-14-17-19(21)22/h8,10,13,16,18,20H,2-7,9,11-12,14-15,17H2,1H3,(H,21,22)/b10-8-,16-13+/t18-/m1/s1 |
| InChIKey | JHFOVTLNYHMZSE-POEMTPSNSA-N |
| XLogP | 5.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|