(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid

C19H34O3 — CID 125480190

IUPAC(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid
SMILESCCCCC[C@@H](O)/C=C/C=C\CCCCCCCCC(=O)O
InChIInChI=1S/C19H34O3/c1-2-3-12-15-18(20)16-13-10-8-6-4-5-7-9-11-14-17-19(21)22/h8,10,13,16,18,20H,2-7,9,11-12,14-15,17H2,1H3,(H,21,22)/b10-8-,16-13+/t18-/m1/s1
InChIKeyJHFOVTLNYHMZSE-POEMTPSNSA-N
MW310.48 g/mol
LogP5.25
Rot. Bonds15

About (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid

(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid (PubChem CID 125480190) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid.

Molecular Properties

Compound Name(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid
PubChem CID125480190
Molecular FormulaC19H34O3
Molecular Weight310.48 g/mol
Exact Mass310.25
IUPAC Name(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid
SMILESCCCCC[C@@H](O)/C=C/C=C\CCCCCCCCC(=O)O
InChIInChI=1S/C19H34O3/c1-2-3-12-15-18(20)16-13-10-8-6-4-5-7-9-11-14-17-19(21)22/h8,10,13,16,18,20H,2-7,9,11-12,14-15,17H2,1H3,(H,21,22)/b10-8-,16-13+/t18-/m1/s1
InChIKeyJHFOVTLNYHMZSE-POEMTPSNSA-N
XLogP5.25
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500310.48
LogP ≤ 55.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid?
The IUPAC name of (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid (CID 125480190) is (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid.
What is the SMILES notation for (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid?
The canonical SMILES for (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid is CCCCC[C@@H](O)/C=C/C=C\CCCCCCCCC(=O)O.
What is the InChIKey of (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid?
The InChIKey is JHFOVTLNYHMZSE-POEMTPSNSA-N. The full InChI is InChI=1S/C19H34O3/c1-2-3-12-15-18(20)16-13-10-8-6-4-5-7-9-11-14-17-19(21)22/h8,10,13,16,18,20H,2-7,9,11-12,14-15,17H2,1H3,(H,21,22)/b10-8-,16-13+/t18-/m1/s1.
What are the key properties of (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid?
(10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid has a molecular weight of 310.48 g/mol, XLogP of 5.25, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10Z,12E,14R)-14-hydroxynonadeca-10,12-dienoic acid is sourced from PubChem (CID 125480190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).