C15H26O3 — CID 124636388
(6E,8Z,10S)-10-hydroxypentadeca-6,8-dienoic acid (PubChem CID 124636388) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (6E,8Z,10S)-10-hydroxypentadeca-6,8-dienoic acid.
| Compound Name | (6E,8Z,10S)-10-hydroxypentadeca-6,8-dienoic acid |
|---|---|
| PubChem CID | 124636388 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (6E,8Z,10S)-10-hydroxypentadeca-6,8-dienoic acid |
| SMILES | CCCCC[C@H](O)/C=C\C=C\CCCCC(=O)O |
| InChI | InChI=1S/C15H26O3/c1-2-3-8-11-14(16)12-9-6-4-5-7-10-13-15(17)18/h4,6,9,12,14,16H,2-3,5,7-8,10-11,13H2,1H3,(H,17,18)/b6-4+,12-9-/t14-/m0/s1 |
| InChIKey | YMUBHSXLIUZNHH-NXDVOLAESA-N |
| XLogP | 3.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|