C18H34O4 — CID 56776194
(Z)-7,10-dihydroxyoctadec-8-enoic acid (PubChem CID 56776194) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (Z)-7,10-dihydroxyoctadec-8-enoic acid.
| Compound Name | (Z)-7,10-dihydroxyoctadec-8-enoic acid |
|---|---|
| PubChem CID | 56776194 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (Z)-7,10-dihydroxyoctadec-8-enoic acid |
| SMILES | CCCCCCCCC(O)/C=C\C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-6-8-11-16(19)14-15-17(20)12-9-7-10-13-18(21)22/h14-17,19-20H,2-13H2,1H3,(H,21,22)/b15-14- |
| InChIKey | IPRLELFMTNDNMN-PFONDFGASA-N |
| XLogP | 4.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|