(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid

C20H38O4 — CID 10315363

IUPAC(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid
SMILESCCCCCCC[C@H](O)/C=C/[C@@H](O)CCCCCCCCC(=O)O
InChIInChI=1S/C20H38O4/c1-2-3-4-7-10-13-18(21)16-17-19(22)14-11-8-5-6-9-12-15-20(23)24/h16-19,21-22H,2-15H2,1H3,(H,23,24)/b17-16+/t18-,19-/m0/s1
InChIKeyMRYCEEUMGDLPKJ-YEORSSJUSA-N
MW342.52 g/mol
LogP4.83
Rot. Bonds17

About (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid

(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid (PubChem CID 10315363) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid.

Molecular Properties

Compound Name(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid
PubChem CID10315363
Molecular FormulaC20H38O4
Molecular Weight342.52 g/mol
Exact Mass342.28
IUPAC Name(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid
SMILESCCCCCCC[C@H](O)/C=C/[C@@H](O)CCCCCCCCC(=O)O
InChIInChI=1S/C20H38O4/c1-2-3-4-7-10-13-18(21)16-17-19(22)14-11-8-5-6-9-12-15-20(23)24/h16-19,21-22H,2-15H2,1H3,(H,23,24)/b17-16+/t18-,19-/m0/s1
InChIKeyMRYCEEUMGDLPKJ-YEORSSJUSA-N
XLogP4.83
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds17
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.52
LogP ≤ 54.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid?
The IUPAC name of (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid (CID 10315363) is (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid.
What is the SMILES notation for (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid?
The canonical SMILES for (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid is CCCCCCC[C@H](O)/C=C/[C@@H](O)CCCCCCCCC(=O)O.
What is the InChIKey of (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid?
The InChIKey is MRYCEEUMGDLPKJ-YEORSSJUSA-N. The full InChI is InChI=1S/C20H38O4/c1-2-3-4-7-10-13-18(21)16-17-19(22)14-11-8-5-6-9-12-15-20(23)24/h16-19,21-22H,2-15H2,1H3,(H,23,24)/b17-16+/t18-,19-/m0/s1.
What are the key properties of (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid?
(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid has a molecular weight of 342.52 g/mol, XLogP of 4.83, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid is sourced from PubChem (CID 10315363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).