C20H38O4 — CID 10315363
(E,10S,13S)-10,13-dihydroxyicos-11-enoic acid (PubChem CID 10315363) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid.
| Compound Name | (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid |
|---|---|
| PubChem CID | 10315363 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | (E,10S,13S)-10,13-dihydroxyicos-11-enoic acid |
| SMILES | CCCCCCC[C@H](O)/C=C/[C@@H](O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O4/c1-2-3-4-7-10-13-18(21)16-17-19(22)14-11-8-5-6-9-12-15-20(23)24/h16-19,21-22H,2-15H2,1H3,(H,23,24)/b17-16+/t18-,19-/m0/s1 |
| InChIKey | MRYCEEUMGDLPKJ-YEORSSJUSA-N |
| XLogP | 4.83 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|