C22H36O3 — CID 72739138
ethyl 15-hydroxyicosa-5,8,11,13-tetraenoate (PubChem CID 72739138) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is ethyl 15-hydroxyicosa-5,8,11,13-tetraenoate.
| Compound Name | ethyl 15-hydroxyicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 72739138 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | ethyl 15-hydroxyicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCCC(O)C=CC=CCC=CCC=CCCCC(=O)OCC |
| InChI | InChI=1S/C22H36O3/c1-3-5-15-18-21(23)19-16-13-11-9-7-6-8-10-12-14-17-20-22(24)25-4-2/h6-7,10-13,16,19,21,23H,3-5,8-9,14-15,17-18,20H2,1-2H3 |
| InChIKey | DXWNFRGRLVMUIG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|