C36H62O6 — CID 157005412
[(2R)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate (PubChem CID 157005412) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157005412 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | [(2R)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](O)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H62O6/c1-4-6-20-26-33(37)27-22-17-12-10-8-7-9-11-13-18-23-28-35(39)41-30-34(38)31-42-36(40)29-24-19-15-14-16-21-25-32(3)5-2/h7-8,11-13,17,22,27,32-34,37-38H,4-6,9-10,14-16,18-21,23-26,28-31H2,1-3H3/b8-7-,13-11-,17-12-,27-22+/t32?,33-,34+/m1/s1 |
| InChIKey | GHXNJYBYCHTWHQ-QSLBGRFXSA-N |
| XLogP | 8.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|