C36H62O6 — CID 157005421
[(2S)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate (PubChem CID 157005421) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate.
| Compound Name | [(2S)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
|---|---|
| PubChem CID | 157005421 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | [(2S)-2-hydroxy-3-(10-methyldodecanoyloxy)propyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
| SMILES | CCCCC/C=C\C=C/[C@@H](O)C/C=C\C/C=C/CCCC(=O)OC[C@@H](O)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H62O6/c1-4-6-7-8-10-16-21-26-33(37)27-22-17-11-9-12-18-23-28-35(39)41-30-34(38)31-42-36(40)29-24-19-14-13-15-20-25-32(3)5-2/h9-10,12,16-17,21-22,26,32-34,37-38H,4-8,11,13-15,18-20,23-25,27-31H2,1-3H3/b12-9+,16-10-,22-17-,26-21-/t32?,33-,34-/m1/s1 |
| InChIKey | DUVAQXIRJZDZGR-ZCXUXMOBSA-N |
| XLogP | 8.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|