C18H33O3- — CID 171037416
(Z)-11-hydroxyoctadec-9-enoate (PubChem CID 171037416) has the molecular formula C18H33O3- and a molecular weight of 297.46 g/mol. Its IUPAC name is (Z)-11-hydroxyoctadec-9-enoate.
| Compound Name | (Z)-11-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 171037416 |
| Molecular Formula | C18H33O3- |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | (Z)-11-hydroxyoctadec-9-enoate |
| SMILES | CCCCCCCC(O)/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-8-11-14-17(19)15-12-9-6-5-7-10-13-16-18(20)21/h12,15,17,19H,2-11,13-14,16H2,1H3,(H,20,21)/p-1/b15-12- |
| InChIKey | MHBZYZVYSHCDLI-QINSGFPZSA-M |
| XLogP | 3.74 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|