About henicos-7-en-6-ol
henicos-7-en-6-ol (PubChem CID 91409967) has the molecular formula C21H42O
and a molecular weight of 310.57 g/mol. Its IUPAC name is henicos-7-en-6-ol.
Molecular Properties
| Compound Name | henicos-7-en-6-ol |
| PubChem CID | 91409967 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | henicos-7-en-6-ol |
| SMILES | CCCCCCCCCCCCCC=CC(O)CCCCC |
| InChI | InChI=1S/C21H42O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-21(22)19-17-6-4-2/h18,20-22H,3-17,19H2,1-2H3 |
| InChIKey | YHVQBXLCZVYELA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze henicos-7-en-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicos-7-en-6-ol?
The IUPAC name of henicos-7-en-6-ol (CID 91409967) is henicos-7-en-6-ol.
What is the SMILES notation for henicos-7-en-6-ol?
The canonical SMILES for henicos-7-en-6-ol is CCCCCCCCCCCCCC=CC(O)CCCCC.
What is the InChIKey of henicos-7-en-6-ol?
The InChIKey is YHVQBXLCZVYELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-21(22)19-17-6-4-2/h18,20-22H,3-17,19H2,1-2H3.
What are the key properties of henicos-7-en-6-ol?
henicos-7-en-6-ol has a molecular weight of 310.57 g/mol, XLogP of 7.18, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for henicos-7-en-6-ol is sourced from PubChem (CID 91409967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).