C20H38O2 — CID 91200816
(16R)-icosa-5,14-diene-1,16-diol (PubChem CID 91200816) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (16R)-icosa-5,14-diene-1,16-diol.
| Compound Name | (16R)-icosa-5,14-diene-1,16-diol |
|---|---|
| PubChem CID | 91200816 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (16R)-icosa-5,14-diene-1,16-diol |
| SMILES | CCCC[C@@H](O)C=CCCCCCCCC=CCCCCO |
| InChI | InChI=1S/C20H38O2/c1-2-3-17-20(22)18-15-13-11-9-7-5-4-6-8-10-12-14-16-19-21/h8,10,15,18,20-22H,2-7,9,11-14,16-17,19H2,1H3/t20-/m1/s1 |
| InChIKey | LTDLJUKZWLOZFH-HXUWFJFHSA-N |
| XLogP | 5.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|