C18H36O2 — CID 10265918
(E)-octadec-6-ene-1,8-diol (PubChem CID 10265918) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is (E)-octadec-6-ene-1,8-diol.
| Compound Name | (E)-octadec-6-ene-1,8-diol |
|---|---|
| PubChem CID | 10265918 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | (E)-octadec-6-ene-1,8-diol |
| SMILES | CCCCCCCCCCC(O)/C=C/CCCCCO |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19/h13,16,18-20H,2-12,14-15,17H2,1H3/b16-13+ |
| InChIKey | HWECWVNNXTYCMM-DTQAZKPQSA-N |
| XLogP | 4.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|