C20H34O2 — CID 59098331
(5Z,8Z,11Z,14Z,16R)-icosa-5,8,11,14-tetraene-1,16-diol (PubChem CID 59098331) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,16R)-icosa-5,8,11,14-tetraene-1,16-diol.
| Compound Name | (5Z,8Z,11Z,14Z,16R)-icosa-5,8,11,14-tetraene-1,16-diol |
|---|---|
| PubChem CID | 59098331 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (5Z,8Z,11Z,14Z,16R)-icosa-5,8,11,14-tetraene-1,16-diol |
| SMILES | CCCC[C@@H](O)/C=C\C/C=C\C/C=C\C/C=C\CCCCO |
| InChI | InChI=1S/C20H34O2/c1-2-3-17-20(22)18-15-13-11-9-7-5-4-6-8-10-12-14-16-19-21/h4-5,8-11,15,18,20-22H,2-3,6-7,12-14,16-17,19H2,1H3/b5-4-,10-8-,11-9-,18-15-/t20-/m1/s1 |
| InChIKey | BBEGPZYAQJUIBP-POJQKJBPSA-N |
| XLogP | 5.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|