C18H33O4- — CID 86289553
(E)-10-hydroperoxyoctadec-8-enoate (PubChem CID 86289553) has the molecular formula C18H33O4- and a molecular weight of 313.46 g/mol. Its IUPAC name is (E)-10-hydroperoxyoctadec-8-enoate.
| Compound Name | (E)-10-hydroperoxyoctadec-8-enoate |
|---|---|
| PubChem CID | 86289553 |
| Molecular Formula | C18H33O4- |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (E)-10-hydroperoxyoctadec-8-enoate |
| SMILES | CCCCCCCCC(/C=C/CCCCCCC(=O)[O-])OO |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-8-11-14-17(22-21)15-12-9-6-7-10-13-16-18(19)20/h12,15,17,21H,2-11,13-14,16H2,1H3,(H,19,20)/p-1/b15-12+ |
| InChIKey | HTIQDCPWTUODDW-NTCAYCPXSA-M |
| XLogP | 4.24 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|