C18H32O4 — CID 5280720
(9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid (PubChem CID 5280720) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid.
| Compound Name | (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid |
|---|---|
| PubChem CID | 5280720 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid |
| SMILES | CCCCC[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/b9-7-,15-12+/t17-/m0/s1 |
| InChIKey | JDSRHVWSAMTSSN-IRQZEAMPSA-N |
| XLogP | 5.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|