C18H31O4 — CID 154714396
CID 154714396 (PubChem CID 154714396) has the molecular formula C18H31O4 and a molecular weight of 311.44 g/mol.
| Compound Name | CID 154714396 |
|---|---|
| PubChem CID | 154714396 |
| Molecular Formula | C18H31O4 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | — |
| SMILES | CCCCC/C=C\C=C/C(CCCCCCCC(=O)O)O[O] |
| InChI | InChI=1S/C18H31O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b8-6-,14-11- |
| InChIKey | HZDJXPKFLRUFKX-ZYCNLYSJSA-N |
| XLogP | 5.23 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|