C23H42N2O4 — CID 118107982
(9Z,11E)-13-[(2S)-2,5-diaminopentanoyl]oxyoctadeca-9,11-dienoic acid (PubChem CID 118107982) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is (9Z,11E)-13-[(2S)-2,5-diaminopentanoyl]oxyoctadeca-9,11-dienoic acid.
| Compound Name | (9Z,11E)-13-[(2S)-2,5-diaminopentanoyl]oxyoctadeca-9,11-dienoic acid |
|---|---|
| PubChem CID | 118107982 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | (9Z,11E)-13-[(2S)-2,5-diaminopentanoyl]oxyoctadeca-9,11-dienoic acid |
| SMILES | CCCCCC(/C=C/C=C\CCCCCCCC(=O)O)OC(=O)[C@@H](N)CCCN |
| InChI | InChI=1S/C23H42N2O4/c1-2-3-11-15-20(29-23(28)21(25)17-14-19-24)16-12-9-7-5-4-6-8-10-13-18-22(26)27/h7,9,12,16,20-21H,2-6,8,10-11,13-15,17-19,24-25H2,1H3,(H,26,27)/b9-7-,16-12+/t20?,21-/m0/s1 |
| InChIKey | IRDAPUJGVCQIAA-IEFHJEDQSA-N |
| XLogP | 4.47 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|