C18H30O6 — CID 10382764
(9Z,11E,13S)-13-hydroperoxy-17-methoxy-17-oxoheptadeca-9,11-dienoic acid (PubChem CID 10382764) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (9Z,11E,13S)-13-hydroperoxy-17-methoxy-17-oxoheptadeca-9,11-dienoic acid.
| Compound Name | (9Z,11E,13S)-13-hydroperoxy-17-methoxy-17-oxoheptadeca-9,11-dienoic acid |
|---|---|
| PubChem CID | 10382764 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (9Z,11E,13S)-13-hydroperoxy-17-methoxy-17-oxoheptadeca-9,11-dienoic acid |
| SMILES | COC(=O)CCC[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H30O6/c1-23-18(21)15-11-13-16(24-22)12-9-7-5-3-2-4-6-8-10-14-17(19)20/h5,7,9,12,16,22H,2-4,6,8,10-11,13-15H2,1H3,(H,19,20)/b7-5-,12-9+/t16-/m1/s1 |
| InChIKey | MVMUXKGYHPLAFT-TUXBOHBLSA-N |
| XLogP | 4.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|