C18H30O4 — CID 6440263
(9E,11E,15E)-13-hydroperoxyoctadeca-9,11,15-trienoic acid (PubChem CID 6440263) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (9E,11E,15E)-13-hydroperoxyoctadeca-9,11,15-trienoic acid.
| Compound Name | (9E,11E,15E)-13-hydroperoxyoctadeca-9,11,15-trienoic acid |
|---|---|
| PubChem CID | 6440263 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (9E,11E,15E)-13-hydroperoxyoctadeca-9,11,15-trienoic acid |
| SMILES | CC/C=C/CC(/C=C/C=C/CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H30O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h3,7,9,11-12,15,17,21H,2,4-6,8,10,13-14,16H2,1H3,(H,19,20)/b9-7+,11-3+,15-12+ |
| InChIKey | UYQGVDXDXBAABN-YPPMWDAJSA-N |
| XLogP | 5.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|